Hechtsberg quarry, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germanyi
| Regional Level Types | |
|---|---|
| Hechtsberg quarry | Quarry |
| Hausach | Municipality |
| Hausach | Administrative Community |
| Ortenaukreis | District |
| Freiburg Region | Region |
| Baden-Württemberg | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
48° 16' 46'' North , 8° 8' 5'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Fischerbach | 1,639 (2017) | 2.0km |
| Hausach | 5,748 (2013) | 3.1km |
| Mühlenbach | 1,698 (2011) | 3.6km |
| Hofstetten | 1,661 (2017) | 5.6km |
| Wolfach | 5,998 (2013) | 6.2km |
Other Languages:
German:
Steinbruch am Hechtsberg, Hausach, Hausach, Ortenaukreis, Regierungsbezirk Freiburg, Baden-Württemberg, Deutschland
Quarry in biotite gneisses with rare Bi-Co-Cu mineralizations.
Located on Hechtsberg mountain, 3.5 km east of Haslach.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
44 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Beyerite Formula: Ca(BiO)2(CO3)2 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismutite Formula: (BiO)2CO3 References: |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Eulytine Formula: Bi4(SiO4)3 References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Galena Formula: PbS References: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Hechtsbergite (TL) Formula: Bi2(VO4)O(OH) Type Locality: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Heterogenite Formula: Co3+O(OH) References: |
| ⓘ Heterogenite var. Heubachite Formula: (Co,Ni)O(OH) References: |
| ⓘ Lautite Formula: CuAsS |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ 'Manganogel' Formula: ~MnO2 · nH2O |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Namibite Formula: Cu(BiO)2(VO4)(OH) |
| ⓘ Native Silver Formula: Ag |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Rammelsbergite Formula: NiAs2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ 'Synchysite Group' |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Wittichenite Formula: Cu3BiS3 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Lautite | 2.CB.40 | CuAsS |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Rammelsbergite | 2.EB.15a | NiAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | var. Heubachite | 4.FE.20 | (Co,Ni)O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Beyerite | 5.BE.35 | Ca(BiO)2(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Namibite | 8.BB.50 | Cu(BiO)2(VO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hechtsbergite (TL) | 8.BO.15 | Bi2(VO4)O(OH) |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Eulytine | 9.AD.40 | Bi4(SiO4)3 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Manganogel' | - | ~MnO2 · nH2O |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Synchysite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Manganogel | ~MnO2 · nH2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Eulytine | Bi4(SiO4)3 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Manganogel | ~MnO2 · nH2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Eulytine | Bi4(SiO4)3 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Lautite | CuAsS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| V | Vanadium | |
| V | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| V | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
| Mn | Manganese | |
| Mn | ⓘ Manganogel | ~MnO2 · nH2O |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Co | Cobalt | |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Heterogenite var. Heubachite | (Co,Ni)O(OH) |
| Ni | ⓘ Rammelsbergite | NiAs2 |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Lautite | CuAsS |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Lautite | CuAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Rammelsbergite | NiAs2 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Pb | Lead | |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Beyerite | Ca(BiO)2(CO3)2 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Eulytine | Bi4(SiO4)3 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| Bi | ⓘ Hechtsbergite | Bi2(VO4)O(OH) |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
Germany
- Baden-Württemberg
- Black ForestMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Hechtsberg quarry, Hausach, Hausach, Ortenaukreis, Freiburg Region, Baden-Württemberg, Germany